C16H20BrNO3 — CID 86606684
ethyl (E)-3-[5-bromo-2-(3-hydroxypyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate (PubChem CID 86606684) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is ethyl (E)-3-[5-bromo-2-(3-hydroxypyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[5-bromo-2-(3-hydroxypyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 86606684 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | ethyl (E)-3-[5-bromo-2-(3-hydroxypyrrolidin-1-yl)phenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1cc(Br)ccc1N1CCC(O)C1 |
| InChI | InChI=1S/C16H20BrNO3/c1-3-21-16(20)11(2)8-12-9-13(17)4-5-15(12)18-7-6-14(19)10-18/h4-5,8-9,14,19H,3,6-7,10H2,1-2H3/b11-8+ |
| InChIKey | QZGCKVNHSGDDJC-DHZHZOJOSA-N |
| XLogP | 2.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|