C20H26BrNO4 — CID 91428070
tert-butyl 3-[2-(3-acetyloxypyrrolidin-1-yl)-5-bromophenyl]-2-methylprop-2-enoate (PubChem CID 91428070) has the molecular formula C20H26BrNO4 and a molecular weight of 424.34 g/mol. Its IUPAC name is tert-butyl 3-[2-(3-acetyloxypyrrolidin-1-yl)-5-bromophenyl]-2-methylprop-2-enoate.
| Compound Name | tert-butyl 3-[2-(3-acetyloxypyrrolidin-1-yl)-5-bromophenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91428070 |
| Molecular Formula | C20H26BrNO4 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | tert-butyl 3-[2-(3-acetyloxypyrrolidin-1-yl)-5-bromophenyl]-2-methylprop-2-enoate |
| SMILES | CC(=O)OC1CCN(c2ccc(Br)cc2C=C(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H26BrNO4/c1-13(19(24)26-20(3,4)5)10-15-11-16(21)6-7-18(15)22-9-8-17(12-22)25-14(2)23/h6-7,10-11,17H,8-9,12H2,1-5H3 |
| InChIKey | LPMYWBSWASQJRM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|