C14H16BrNO5 — CID 177290660
[(3R)-1-[2-bromo-5-hydroxy-4-(2-hydroxyacetyl)phenyl]pyrrolidin-3-yl] acetate (PubChem CID 177290660) has the molecular formula C14H16BrNO5 and a molecular weight of 358.19 g/mol. Its IUPAC name is [(3R)-1-[2-bromo-5-hydroxy-4-(2-hydroxyacetyl)phenyl]pyrrolidin-3-yl] acetate.
| Compound Name | [(3R)-1-[2-bromo-5-hydroxy-4-(2-hydroxyacetyl)phenyl]pyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 177290660 |
| Molecular Formula | C14H16BrNO5 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | [(3R)-1-[2-bromo-5-hydroxy-4-(2-hydroxyacetyl)phenyl]pyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCN(c2cc(O)c(C(=O)CO)cc2Br)C1 |
| InChI | InChI=1S/C14H16BrNO5/c1-8(18)21-9-2-3-16(6-9)12-5-13(19)10(4-11(12)15)14(20)7-17/h4-5,9,17,19H,2-3,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | PRGJVDLLVSBOII-SECBINFHSA-N |
| XLogP | 1.47 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |