C21H24F3NO3 — CID 163524419
1-nitroso-2-octoxy-4-[4-(trifluoromethoxy)phenyl]benzene (PubChem CID 163524419) has the molecular formula C21H24F3NO3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 1-nitroso-2-octoxy-4-[4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1-nitroso-2-octoxy-4-[4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 163524419 |
| Molecular Formula | C21H24F3NO3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-nitroso-2-octoxy-4-[4-(trifluoromethoxy)phenyl]benzene |
| SMILES | CCCCCCCCOc1cc(-c2ccc(OC(F)(F)F)cc2)ccc1N=O |
| InChI | InChI=1S/C21H24F3NO3/c1-2-3-4-5-6-7-14-27-20-15-17(10-13-19(20)25-26)16-8-11-18(12-9-16)28-21(22,23)24/h8-13,15H,2-7,14H2,1H3 |
| InChIKey | DNNJBRXNYPNZPF-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|