C27H25F3O4 — CID 58008126
(E)-3-[2-(5-phenylpentoxy)-5-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid (PubChem CID 58008126) has the molecular formula C27H25F3O4 and a molecular weight of 470.49 g/mol. Its IUPAC name is (E)-3-[2-(5-phenylpentoxy)-5-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(5-phenylpentoxy)-5-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58008126 |
| Molecular Formula | C27H25F3O4 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (E)-3-[2-(5-phenylpentoxy)-5-[4-(trifluoromethoxy)phenyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(-c2ccc(OC(F)(F)F)cc2)ccc1OCCCCCc1ccccc1 |
| InChI | InChI=1S/C27H25F3O4/c28-27(29,30)34-24-14-10-21(11-15-24)22-12-16-25(23(19-22)13-17-26(31)32)33-18-6-2-5-9-20-7-3-1-4-8-20/h1,3-4,7-8,10-17,19H,2,5-6,9,18H2,(H,31,32)/b17-13+ |
| InChIKey | VRWGWUIKYIRIHG-GHRIWEEISA-N |
| XLogP | 7.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|