C27H30F3NO2 — CID 58008304
N-butyl-2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenyl]aniline (PubChem CID 58008304) has the molecular formula C27H30F3NO2 and a molecular weight of 457.54 g/mol. Its IUPAC name is N-butyl-2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenyl]aniline.
| Compound Name | N-butyl-2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 58008304 |
| Molecular Formula | C27H30F3NO2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-butyl-2-(4-phenylbutoxy)-5-[4-(trifluoromethoxy)phenyl]aniline |
| SMILES | CCCCNc1cc(-c2ccc(OC(F)(F)F)cc2)ccc1OCCCCc1ccccc1 |
| InChI | InChI=1S/C27H30F3NO2/c1-2-3-18-31-25-20-23(22-12-15-24(16-13-22)33-27(28,29)30)14-17-26(25)32-19-8-7-11-21-9-5-4-6-10-21/h4-6,9-10,12-17,20,31H,2-3,7-8,11,18-19H2,1H3 |
| InChIKey | IBVMOUDXGYCNGI-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|