C28H27F3O3 — CID 143874982
2-[4-[(1R)-2-tert-butylcyclobutyl]phenoxy]-4-[4-(trifluoromethoxy)phenyl]benzaldehyde (PubChem CID 143874982) has the molecular formula C28H27F3O3 and a molecular weight of 468.52 g/mol. Its IUPAC name is 2-[4-[(1R)-2-tert-butylcyclobutyl]phenoxy]-4-[4-(trifluoromethoxy)phenyl]benzaldehyde.
| Compound Name | 2-[4-[(1R)-2-tert-butylcyclobutyl]phenoxy]-4-[4-(trifluoromethoxy)phenyl]benzaldehyde |
|---|---|
| PubChem CID | 143874982 |
| Molecular Formula | C28H27F3O3 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-[4-[(1R)-2-tert-butylcyclobutyl]phenoxy]-4-[4-(trifluoromethoxy)phenyl]benzaldehyde |
| SMILES | CC(C)(C)C1CC[C@H]1c1ccc(Oc2cc(-c3ccc(OC(F)(F)F)cc3)ccc2C=O)cc1 |
| InChI | InChI=1S/C28H27F3O3/c1-27(2,3)25-15-14-24(25)19-8-10-22(11-9-19)33-26-16-20(4-5-21(26)17-32)18-6-12-23(13-7-18)34-28(29,30)31/h4-13,16-17,24-25H,14-15H2,1-3H3/t24-,25?/m0/s1 |
| InChIKey | VFSFQLLKEMXPCL-SKCDSABHSA-N |
| XLogP | 8.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|