C24H23F3O3 — CID 58007706
[2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenyl]methanol (PubChem CID 58007706) has the molecular formula C24H23F3O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is [2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenyl]methanol.
| Compound Name | [2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 58007706 |
| Molecular Formula | C24H23F3O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [2-(4-tert-butylphenoxy)-4-[4-(trifluoromethoxy)phenyl]phenyl]methanol |
| SMILES | CC(C)(C)c1ccc(Oc2cc(-c3ccc(OC(F)(F)F)cc3)ccc2CO)cc1 |
| InChI | InChI=1S/C24H23F3O3/c1-23(2,3)19-8-12-20(13-9-19)29-22-14-17(4-5-18(22)15-28)16-6-10-21(11-7-16)30-24(25,26)27/h4-14,28H,15H2,1-3H3 |
| InChIKey | RRZBSXVIRAMXKQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |