C28H32Br2O2 — CID 100945891
1,4-bis(bromomethyl)-2,5-bis(4-tert-butylphenoxy)benzene (PubChem CID 100945891) has the molecular formula C28H32Br2O2 and a molecular weight of 560.37 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)-2,5-bis(4-tert-butylphenoxy)benzene.
| Compound Name | 1,4-bis(bromomethyl)-2,5-bis(4-tert-butylphenoxy)benzene |
|---|---|
| PubChem CID | 100945891 |
| Molecular Formula | C28H32Br2O2 |
| Molecular Weight | 560.37 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | 1,4-bis(bromomethyl)-2,5-bis(4-tert-butylphenoxy)benzene |
| SMILES | CC(C)(C)c1ccc(Oc2cc(CBr)c(Oc3ccc(C(C)(C)C)cc3)cc2CBr)cc1 |
| InChI | InChI=1S/C28H32Br2O2/c1-27(2,3)21-7-11-23(12-8-21)31-25-15-20(18-30)26(16-19(25)17-29)32-24-13-9-22(10-14-24)28(4,5)6/h7-16H,17-18H2,1-6H3 |
| InChIKey | WEQSUWWYKSSYBM-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.37 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|