C16H16F2O — CID 70799684
1-(4-tert-butylphenoxy)-2,4-difluorobenzene (PubChem CID 70799684) has the molecular formula C16H16F2O and a molecular weight of 262.30 g/mol. Its IUPAC name is 1-(4-tert-butylphenoxy)-2,4-difluorobenzene.
| Compound Name | 1-(4-tert-butylphenoxy)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 70799684 |
| Molecular Formula | C16H16F2O |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-(4-tert-butylphenoxy)-2,4-difluorobenzene |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C16H16F2O/c1-16(2,3)11-4-7-13(8-5-11)19-15-9-6-12(17)10-14(15)18/h4-10H,1-3H3 |
| InChIKey | FBODQOBQWWABLZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |