C31H38O5 — CID 58007753
ethyl 2-[2-(4-tert-butylphenoxy)-4-(4-pentoxyphenyl)phenoxy]acetate (PubChem CID 58007753) has the molecular formula C31H38O5 and a molecular weight of 490.64 g/mol. Its IUPAC name is ethyl 2-[2-(4-tert-butylphenoxy)-4-(4-pentoxyphenyl)phenoxy]acetate.
| Compound Name | ethyl 2-[2-(4-tert-butylphenoxy)-4-(4-pentoxyphenyl)phenoxy]acetate |
|---|---|
| PubChem CID | 58007753 |
| Molecular Formula | C31H38O5 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | ethyl 2-[2-(4-tert-butylphenoxy)-4-(4-pentoxyphenyl)phenoxy]acetate |
| SMILES | CCCCCOc1ccc(-c2ccc(OCC(=O)OCC)c(Oc3ccc(C(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C31H38O5/c1-6-8-9-20-34-26-15-10-23(11-16-26)24-12-19-28(35-22-30(32)33-7-2)29(21-24)36-27-17-13-25(14-18-27)31(3,4)5/h10-19,21H,6-9,20,22H2,1-5H3 |
| InChIKey | APFCGFCEHAWPPB-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|