C27H27F3O5 — CID 58008162
ethyl 2-[2-(3-tert-butylphenoxy)-4-[3-(trifluoromethoxy)phenyl]phenoxy]acetate (PubChem CID 58008162) has the molecular formula C27H27F3O5 and a molecular weight of 488.50 g/mol. Its IUPAC name is ethyl 2-[2-(3-tert-butylphenoxy)-4-[3-(trifluoromethoxy)phenyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-(3-tert-butylphenoxy)-4-[3-(trifluoromethoxy)phenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 58008162 |
| Molecular Formula | C27H27F3O5 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | ethyl 2-[2-(3-tert-butylphenoxy)-4-[3-(trifluoromethoxy)phenyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(-c2cccc(OC(F)(F)F)c2)cc1Oc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H27F3O5/c1-5-32-25(31)17-33-23-13-12-19(18-8-6-11-22(14-18)35-27(28,29)30)15-24(23)34-21-10-7-9-20(16-21)26(2,3)4/h6-16H,5,17H2,1-4H3 |
| InChIKey | FJYHXUGKAZEHOG-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |