C29H32F3NO4 — CID 58007904
ethyl 3-[2-[(4-tert-butylphenyl)methoxy]-5-[4-(trifluoromethoxy)anilino]phenyl]propanoate (PubChem CID 58007904) has the molecular formula C29H32F3NO4 and a molecular weight of 515.57 g/mol. Its IUPAC name is ethyl 3-[2-[(4-tert-butylphenyl)methoxy]-5-[4-(trifluoromethoxy)anilino]phenyl]propanoate.
| Compound Name | ethyl 3-[2-[(4-tert-butylphenyl)methoxy]-5-[4-(trifluoromethoxy)anilino]phenyl]propanoate |
|---|---|
| PubChem CID | 58007904 |
| Molecular Formula | C29H32F3NO4 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | ethyl 3-[2-[(4-tert-butylphenyl)methoxy]-5-[4-(trifluoromethoxy)anilino]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(Nc2ccc(OC(F)(F)F)cc2)ccc1OCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H32F3NO4/c1-5-35-27(34)17-8-21-18-24(33-23-11-14-25(15-12-23)37-29(30,31)32)13-16-26(21)36-19-20-6-9-22(10-7-20)28(2,3)4/h6-7,9-16,18,33H,5,8,17,19H2,1-4H3 |
| InChIKey | YLCQTPMFPVECQF-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |