C25H22F3NO6 — CID 58007971
ethyl 3-[2-[(4-nitrophenyl)methoxy]-5-[4-(trifluoromethoxy)phenyl]phenyl]propanoate (PubChem CID 58007971) has the molecular formula C25H22F3NO6 and a molecular weight of 489.45 g/mol. Its IUPAC name is ethyl 3-[2-[(4-nitrophenyl)methoxy]-5-[4-(trifluoromethoxy)phenyl]phenyl]propanoate.
| Compound Name | ethyl 3-[2-[(4-nitrophenyl)methoxy]-5-[4-(trifluoromethoxy)phenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 58007971 |
| Molecular Formula | C25H22F3NO6 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | ethyl 3-[2-[(4-nitrophenyl)methoxy]-5-[4-(trifluoromethoxy)phenyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(-c2ccc(OC(F)(F)F)cc2)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H22F3NO6/c1-2-33-24(30)14-8-20-15-19(18-5-11-22(12-6-18)35-25(26,27)28)7-13-23(20)34-16-17-3-9-21(10-4-17)29(31)32/h3-7,9-13,15H,2,8,14,16H2,1H3 |
| InChIKey | LHLLQFLHCBWDIG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|