C17H15F3O3 — CID 142415329
ethyl 4-[4-(1,1-difluoroethyl)phenoxy]-3-fluorobenzoate (PubChem CID 142415329) has the molecular formula C17H15F3O3 and a molecular weight of 324.30 g/mol. Its IUPAC name is ethyl 4-[4-(1,1-difluoroethyl)phenoxy]-3-fluorobenzoate.
| Compound Name | ethyl 4-[4-(1,1-difluoroethyl)phenoxy]-3-fluorobenzoate |
|---|---|
| PubChem CID | 142415329 |
| Molecular Formula | C17H15F3O3 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | ethyl 4-[4-(1,1-difluoroethyl)phenoxy]-3-fluorobenzoate |
| SMILES | CCOC(=O)c1ccc(Oc2ccc(C(C)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C17H15F3O3/c1-3-22-16(21)11-4-9-15(14(18)10-11)23-13-7-5-12(6-8-13)17(2,19)20/h4-10H,3H2,1-2H3 |
| InChIKey | ZIOSPBRNMPPULZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |