C17H12ClF4NO4 — CID 167277823
[4-chloro-5-fluoro-2-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl] propanoate (PubChem CID 167277823) has the molecular formula C17H12ClF4NO4 and a molecular weight of 405.73 g/mol. Its IUPAC name is [4-chloro-5-fluoro-2-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl] propanoate.
| Compound Name | [4-chloro-5-fluoro-2-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl] propanoate |
|---|---|
| PubChem CID | 167277823 |
| Molecular Formula | C17H12ClF4NO4 |
| Molecular Weight | 405.73 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | [4-chloro-5-fluoro-2-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(F)c(Cl)cc1C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12ClF4NO4/c1-2-15(24)26-14-8-13(19)12(18)7-11(14)16(25)23-9-3-5-10(6-4-9)27-17(20,21)22/h3-8H,2H2,1H3,(H,23,25) |
| InChIKey | PIOUWRCQENENHF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.73 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|