C17H11ClF5NO4 — CID 55365077
[1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-chloro-4,5-difluorobenzoate (PubChem CID 55365077) has the molecular formula C17H11ClF5NO4 and a molecular weight of 423.72 g/mol. Its IUPAC name is [1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 55365077 |
| Molecular Formula | C17H11ClF5NO4 |
| Molecular Weight | 423.72 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | [1-oxo-1-[4-(trifluoromethoxy)anilino]propan-2-yl] 2-chloro-4,5-difluorobenzoate |
| SMILES | CC(OC(=O)c1cc(F)c(F)cc1Cl)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11ClF5NO4/c1-8(27-16(26)11-6-13(19)14(20)7-12(11)18)15(25)24-9-2-4-10(5-3-9)28-17(21,22)23/h2-8H,1H3,(H,24,25) |
| InChIKey | YYTDGOIRPSKFME-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.72 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|