C18H24F3N3O3 — CID 109028870
ethyl 4-[3-[4-(trifluoromethyl)anilino]propanoylamino]piperidine-1-carboxylate (PubChem CID 109028870) has the molecular formula C18H24F3N3O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is ethyl 4-[3-[4-(trifluoromethyl)anilino]propanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-[4-(trifluoromethyl)anilino]propanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109028870 |
| Molecular Formula | C18H24F3N3O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | ethyl 4-[3-[4-(trifluoromethyl)anilino]propanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCNc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H24F3N3O3/c1-2-27-17(26)24-11-8-15(9-12-24)23-16(25)7-10-22-14-5-3-13(4-6-14)18(19,20)21/h3-6,15,22H,2,7-12H2,1H3,(H,23,25) |
| InChIKey | NUGORIWONJQKHF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |