C16H17BrF3NO3 — CID 146435290
ethyl 1-[(2-bromoacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]cyclopropane-1-carboxylate (PubChem CID 146435290) has the molecular formula C16H17BrF3NO3 and a molecular weight of 408.21 g/mol. Its IUPAC name is ethyl 1-[(2-bromoacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[(2-bromoacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 146435290 |
| Molecular Formula | C16H17BrF3NO3 |
| Molecular Weight | 408.21 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | ethyl 1-[(2-bromoacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(N(Cc2ccc(C(F)(F)F)cc2)C(=O)CBr)CC1 |
| InChI | InChI=1S/C16H17BrF3NO3/c1-2-24-14(23)15(7-8-15)21(13(22)9-17)10-11-3-5-12(6-4-11)16(18,19)20/h3-6H,2,7-10H2,1H3 |
| InChIKey | HRDMDZQOPMZQMG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|