C19H17BrF3NO3 — CID 67189049
ethyl 2-[(2-bromophenyl)methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-oxoacetate (PubChem CID 67189049) has the molecular formula C19H17BrF3NO3 and a molecular weight of 444.25 g/mol. Its IUPAC name is ethyl 2-[(2-bromophenyl)methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[(2-bromophenyl)methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 67189049 |
| Molecular Formula | C19H17BrF3NO3 |
| Molecular Weight | 444.25 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | ethyl 2-[(2-bromophenyl)methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N(Cc1ccc(C(F)(F)F)cc1)Cc1ccccc1Br |
| InChI | InChI=1S/C19H17BrF3NO3/c1-2-27-18(26)17(25)24(12-14-5-3-4-6-16(14)20)11-13-7-9-15(10-8-13)19(21,22)23/h3-10H,2,11-12H2,1H3 |
| InChIKey | ZJFQEOOYXTZREU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.25 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|