C23H19BrF3NO3 — CID 67185469
ethyl 2-[(4-bromonaphthalen-1-yl)methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-oxoacetate (PubChem CID 67185469) has the molecular formula C23H19BrF3NO3 and a molecular weight of 494.31 g/mol. Its IUPAC name is ethyl 2-[(4-bromonaphthalen-1-yl)methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[(4-bromonaphthalen-1-yl)methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 67185469 |
| Molecular Formula | C23H19BrF3NO3 |
| Molecular Weight | 494.31 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | ethyl 2-[(4-bromonaphthalen-1-yl)methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N(Cc1ccc(C(F)(F)F)cc1)Cc1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C23H19BrF3NO3/c1-2-31-22(30)21(29)28(13-15-7-10-17(11-8-15)23(25,26)27)14-16-9-12-20(24)19-6-4-3-5-18(16)19/h3-12H,2,13-14H2,1H3 |
| InChIKey | XOKFDKLDUZAPHI-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.31 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|