C20H21F3N2O2 — CID 142844508
ethyl (Z)-2-[amino(benzyl)amino]-4-[4-(trifluoromethyl)phenyl]but-2-enoate (PubChem CID 142844508) has the molecular formula C20H21F3N2O2 and a molecular weight of 378.39 g/mol. Its IUPAC name is ethyl (Z)-2-[amino(benzyl)amino]-4-[4-(trifluoromethyl)phenyl]but-2-enoate.
| Compound Name | ethyl (Z)-2-[amino(benzyl)amino]-4-[4-(trifluoromethyl)phenyl]but-2-enoate |
|---|---|
| PubChem CID | 142844508 |
| Molecular Formula | C20H21F3N2O2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | ethyl (Z)-2-[amino(benzyl)amino]-4-[4-(trifluoromethyl)phenyl]but-2-enoate |
| SMILES | CCOC(=O)/C(=C/Cc1ccc(C(F)(F)F)cc1)N(N)Cc1ccccc1 |
| InChI | InChI=1S/C20H21F3N2O2/c1-2-27-19(26)18(25(24)14-16-6-4-3-5-7-16)13-10-15-8-11-17(12-9-15)20(21,22)23/h3-9,11-13H,2,10,14,24H2,1H3/b18-13- |
| InChIKey | KCRQAZDBNLCAIH-AQTBWJFISA-N |
| XLogP | 4.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|