C11H9F3O3 — CID 115007362
(Z)-2-hydroxy-4-[4-(trifluoromethyl)phenyl]but-2-enoic acid (PubChem CID 115007362) has the molecular formula C11H9F3O3 and a molecular weight of 246.18 g/mol. Its IUPAC name is (Z)-2-hydroxy-4-[4-(trifluoromethyl)phenyl]but-2-enoic acid.
| Compound Name | (Z)-2-hydroxy-4-[4-(trifluoromethyl)phenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 115007362 |
| Molecular Formula | C11H9F3O3 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (Z)-2-hydroxy-4-[4-(trifluoromethyl)phenyl]but-2-enoic acid |
| SMILES | O=C(O)/C(O)=C/Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F3O3/c12-11(13,14)8-4-1-7(2-5-8)3-6-9(15)10(16)17/h1-2,4-6,15H,3H2,(H,16,17)/b9-6- |
| InChIKey | CDKFWNOECIHITP-TWGQIWQCSA-N |
| XLogP | 2.77 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|