C14H19F3N2O — CID 178067829
2,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]butanehydrazide (PubChem CID 178067829) has the molecular formula C14H19F3N2O and a molecular weight of 288.31 g/mol. Its IUPAC name is 2,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]butanehydrazide.
| Compound Name | 2,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]butanehydrazide |
|---|---|
| PubChem CID | 178067829 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2,2-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]butanehydrazide |
| SMILES | CCC(C)(C)C(=O)N(N)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3N2O/c1-4-13(2,3)12(20)19(18)9-10-5-7-11(8-6-10)14(15,16)17/h5-8H,4,9,18H2,1-3H3 |
| InChIKey | JBFXBGVNVPQLEX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|