C22H22F6N2S4 — CID 176733101
[ethyl-[[4-(trifluoromethyl)phenyl]methyl]carbamothioyl]sulfanyl N-ethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamodithioate (PubChem CID 176733101) has the molecular formula C22H22F6N2S4 and a molecular weight of 556.69 g/mol. Its IUPAC name is [ethyl-[[4-(trifluoromethyl)phenyl]methyl]carbamothioyl]sulfanyl N-ethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamodithioate.
| Compound Name | [ethyl-[[4-(trifluoromethyl)phenyl]methyl]carbamothioyl]sulfanyl N-ethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamodithioate |
|---|---|
| PubChem CID | 176733101 |
| Molecular Formula | C22H22F6N2S4 |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | [ethyl-[[4-(trifluoromethyl)phenyl]methyl]carbamothioyl]sulfanyl N-ethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamodithioate |
| SMILES | CCN(Cc1ccc(C(F)(F)F)cc1)C(=S)SSC(=S)N(CC)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F6N2S4/c1-3-29(13-15-5-9-17(10-6-15)21(23,24)25)19(31)33-34-20(32)30(4-2)14-16-7-11-18(12-8-16)22(26,27)28/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | FOCGDCAZDKVVHD-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|