C18H22N4S4 — CID 168679323
[ethyl(pyridin-4-ylmethyl)carbamothioyl]sulfanyl N-ethyl-N-(pyridin-4-ylmethyl)carbamodithioate (PubChem CID 168679323) has the molecular formula C18H22N4S4 and a molecular weight of 422.67 g/mol. Its IUPAC name is [ethyl(pyridin-4-ylmethyl)carbamothioyl]sulfanyl N-ethyl-N-(pyridin-4-ylmethyl)carbamodithioate.
| Compound Name | [ethyl(pyridin-4-ylmethyl)carbamothioyl]sulfanyl N-ethyl-N-(pyridin-4-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 168679323 |
| Molecular Formula | C18H22N4S4 |
| Molecular Weight | 422.67 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | [ethyl(pyridin-4-ylmethyl)carbamothioyl]sulfanyl N-ethyl-N-(pyridin-4-ylmethyl)carbamodithioate |
| SMILES | CCN(Cc1ccncc1)C(=S)SSC(=S)N(CC)Cc1ccncc1 |
| InChI | InChI=1S/C18H22N4S4/c1-3-21(13-15-5-9-19-10-6-15)17(23)25-26-18(24)22(4-2)14-16-7-11-20-12-8-16/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | AILZVDWZBXVCJV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.67 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|