C26H21F3NO5- — CID 150037764
4-[4-[[(2-ethoxy-2-oxoacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]phenyl]benzoate (PubChem CID 150037764) has the molecular formula C26H21F3NO5- and a molecular weight of 484.45 g/mol. Its IUPAC name is 4-[4-[[(2-ethoxy-2-oxoacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]phenyl]benzoate.
| Compound Name | 4-[4-[[(2-ethoxy-2-oxoacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 150037764 |
| Molecular Formula | C26H21F3NO5- |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 4-[4-[[(2-ethoxy-2-oxoacetyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]methyl]phenyl]benzoate |
| SMILES | CCOC(=O)C(=O)N(Cc1ccc(-c2ccc(C(=O)[O-])cc2)cc1)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H22F3NO5/c1-2-35-25(34)23(31)30(16-18-5-13-22(14-6-18)26(27,28)29)15-17-3-7-19(8-4-17)20-9-11-21(12-10-20)24(32)33/h3-14H,2,15-16H2,1H3,(H,32,33)/p-1 |
| InChIKey | DIPWMRJZHGURFQ-UHFFFAOYSA-M |
| XLogP | 3.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|