C30H22F3NO4 — CID 67187128
ethyl 2-[4-dibenzofuran-4-yl-N-[[4-(trifluoromethyl)phenyl]methyl]anilino]-2-oxoacetate (PubChem CID 67187128) has the molecular formula C30H22F3NO4 and a molecular weight of 517.50 g/mol. Its IUPAC name is ethyl 2-[4-dibenzofuran-4-yl-N-[[4-(trifluoromethyl)phenyl]methyl]anilino]-2-oxoacetate.
| Compound Name | ethyl 2-[4-dibenzofuran-4-yl-N-[[4-(trifluoromethyl)phenyl]methyl]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 67187128 |
| Molecular Formula | C30H22F3NO4 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | ethyl 2-[4-dibenzofuran-4-yl-N-[[4-(trifluoromethyl)phenyl]methyl]anilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N(Cc1ccc(C(F)(F)F)cc1)c1ccc(-c2cccc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C30H22F3NO4/c1-2-37-29(36)28(35)34(18-19-10-14-21(15-11-19)30(31,32)33)22-16-12-20(13-17-22)23-7-5-8-25-24-6-3-4-9-26(24)38-27(23)25/h3-17H,2,18H2,1H3 |
| InChIKey | PCHIQZRRTZZDSU-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|