C21H18O — CID 156827246
4-(4-propylphenyl)dibenzofuran (PubChem CID 156827246) has the molecular formula C21H18O and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-(4-propylphenyl)dibenzofuran.
| Compound Name | 4-(4-propylphenyl)dibenzofuran |
|---|---|
| PubChem CID | 156827246 |
| Molecular Formula | C21H18O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-(4-propylphenyl)dibenzofuran |
| SMILES | CCCc1ccc(-c2cccc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C21H18O/c1-2-6-15-11-13-16(14-12-15)17-8-5-9-19-18-7-3-4-10-20(18)22-21(17)19/h3-5,7-14H,2,6H2,1H3 |
| InChIKey | OZTYLCMWJKNKLA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |