C19H15NO — CID 67186774
(4-dibenzofuran-4-ylphenyl)methanamine (PubChem CID 67186774) has the molecular formula C19H15NO and a molecular weight of 273.34 g/mol. Its IUPAC name is (4-dibenzofuran-4-ylphenyl)methanamine.
| Compound Name | (4-dibenzofuran-4-ylphenyl)methanamine |
|---|---|
| PubChem CID | 67186774 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (4-dibenzofuran-4-ylphenyl)methanamine |
| SMILES | NCc1ccc(-c2cccc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C19H15NO/c20-12-13-8-10-14(11-9-13)15-5-3-6-17-16-4-1-2-7-18(16)21-19(15)17/h1-11H,12,20H2 |
| InChIKey | MZDPGSVLDHQAMW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |