C34H26N2O5 — CID 69308335
ethyl 2-[[4-benzyl-5-(4-dibenzofuran-4-ylphenyl)-2-oxo-1H-pyridin-3-yl]amino]-2-oxoacetate (PubChem CID 69308335) has the molecular formula C34H26N2O5 and a molecular weight of 542.59 g/mol. Its IUPAC name is ethyl 2-[[4-benzyl-5-(4-dibenzofuran-4-ylphenyl)-2-oxo-1H-pyridin-3-yl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[4-benzyl-5-(4-dibenzofuran-4-ylphenyl)-2-oxo-1H-pyridin-3-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 69308335 |
| Molecular Formula | C34H26N2O5 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | ethyl 2-[[4-benzyl-5-(4-dibenzofuran-4-ylphenyl)-2-oxo-1H-pyridin-3-yl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1c(Cc2ccccc2)c(-c2ccc(-c3cccc4c3oc3ccccc34)cc2)c[nH]c1=O |
| InChI | InChI=1S/C34H26N2O5/c1-2-40-34(39)33(38)36-30-27(19-21-9-4-3-5-10-21)28(20-35-32(30)37)23-17-15-22(16-18-23)24-12-8-13-26-25-11-6-7-14-29(25)41-31(24)26/h3-18,20H,2,19H2,1H3,(H,35,37)(H,36,38) |
| InChIKey | SKTGPFQEAVUQLR-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|