C28H23NO3S — CID 11453801
2-amino-3-[[4-(4-dibenzofuran-4-ylphenyl)phenyl]methylsulfanyl]propanoic acid (PubChem CID 11453801) has the molecular formula C28H23NO3S and a molecular weight of 453.56 g/mol. Its IUPAC name is 2-amino-3-[[4-(4-dibenzofuran-4-ylphenyl)phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 2-amino-3-[[4-(4-dibenzofuran-4-ylphenyl)phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 11453801 |
| Molecular Formula | C28H23NO3S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-amino-3-[[4-(4-dibenzofuran-4-ylphenyl)phenyl]methylsulfanyl]propanoic acid |
| SMILES | NC(CSCc1ccc(-c2ccc(-c3cccc4c3oc3ccccc34)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H23NO3S/c29-25(28(30)31)17-33-16-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22-5-3-6-24-23-4-1-2-7-26(23)32-27(22)24/h1-15,25H,16-17,29H2,(H,30,31) |
| InChIKey | LAVKYFDUQRZZHU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |