C29H25N3O3S — CID 59696205
(2R)-2-(diaminomethylideneamino)-3-[[4-(4-dibenzofuran-4-ylphenyl)phenyl]methylsulfanyl]propanoic acid (PubChem CID 59696205) has the molecular formula C29H25N3O3S and a molecular weight of 495.60 g/mol. Its IUPAC name is (2R)-2-(diaminomethylideneamino)-3-[[4-(4-dibenzofuran-4-ylphenyl)phenyl]methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-(diaminomethylideneamino)-3-[[4-(4-dibenzofuran-4-ylphenyl)phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 59696205 |
| Molecular Formula | C29H25N3O3S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | (2R)-2-(diaminomethylideneamino)-3-[[4-(4-dibenzofuran-4-ylphenyl)phenyl]methylsulfanyl]propanoic acid |
| SMILES | NC(N)=N[C@@H](CSCc1ccc(-c2ccc(-c3cccc4c3oc3ccccc34)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C29H25N3O3S/c30-29(31)32-25(28(33)34)17-36-16-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22-5-3-6-24-23-4-1-2-7-26(23)35-27(22)24/h1-15,25H,16-17H2,(H,33,34)(H4,30,31,32)/t25-/m0/s1 |
| InChIKey | QWACYGBUEUPEGH-VWLOTQADSA-N |
| XLogP | 5.88 |
| TPSA | 114.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|