C29H23FO3S — CID 11712517
3-[[4-(4-dibenzofuran-4-yl-3-fluorophenyl)phenyl]methylsulfanyl]-2-methylpropanoic acid (PubChem CID 11712517) has the molecular formula C29H23FO3S and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-[[4-(4-dibenzofuran-4-yl-3-fluorophenyl)phenyl]methylsulfanyl]-2-methylpropanoic acid.
| Compound Name | 3-[[4-(4-dibenzofuran-4-yl-3-fluorophenyl)phenyl]methylsulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11712517 |
| Molecular Formula | C29H23FO3S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 3-[[4-(4-dibenzofuran-4-yl-3-fluorophenyl)phenyl]methylsulfanyl]-2-methylpropanoic acid |
| SMILES | CC(CSCc1ccc(-c2ccc(-c3cccc4c3oc3ccccc34)c(F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C29H23FO3S/c1-18(29(31)32)16-34-17-19-9-11-20(12-10-19)21-13-14-22(26(30)15-21)24-6-4-7-25-23-5-2-3-8-27(23)33-28(24)25/h2-15,18H,16-17H2,1H3,(H,31,32) |
| InChIKey | YFJXWIRORSLMLC-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |