C19H19F3N2O3 — CID 177129070
ethyl 2-[(2-methylphenyl)methyl-[[5-(trifluoromethyl)-2-pyridinyl]methyl]amino]-2-oxoacetate (PubChem CID 177129070) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is ethyl 2-[(2-methylphenyl)methyl-[[5-(trifluoromethyl)-2-pyridinyl]methyl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[(2-methylphenyl)methyl-[[5-(trifluoromethyl)-2-pyridinyl]methyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 177129070 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | ethyl 2-[(2-methylphenyl)methyl-[[5-(trifluoromethyl)-2-pyridinyl]methyl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N(Cc1ccc(C(F)(F)F)cn1)Cc1ccccc1C |
| InChI | InChI=1S/C19H19F3N2O3/c1-3-27-18(26)17(25)24(11-14-7-5-4-6-13(14)2)12-16-9-8-15(10-23-16)19(20,21)22/h4-10H,3,11-12H2,1-2H3 |
| InChIKey | OQXXWSKAYGZHPY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|