C17H13ClF4N2O3 — CID 169111883
2,2,2-trifluoroethyl 2-[(2-chloro-4-fluorophenyl)methyl-(pyridin-2-ylmethyl)amino]-2-oxoacetate (PubChem CID 169111883) has the molecular formula C17H13ClF4N2O3 and a molecular weight of 404.75 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(2-chloro-4-fluorophenyl)methyl-(pyridin-2-ylmethyl)amino]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(2-chloro-4-fluorophenyl)methyl-(pyridin-2-ylmethyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 169111883 |
| Molecular Formula | C17H13ClF4N2O3 |
| Molecular Weight | 404.75 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(2-chloro-4-fluorophenyl)methyl-(pyridin-2-ylmethyl)amino]-2-oxoacetate |
| SMILES | O=C(OCC(F)(F)F)C(=O)N(Cc1ccccn1)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H13ClF4N2O3/c18-14-7-12(19)5-4-11(14)8-24(9-13-3-1-2-6-23-13)15(25)16(26)27-10-17(20,21)22/h1-7H,8-10H2 |
| InChIKey | AMIUTODZLMFSDR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|