C20H19F3N2O4 — CID 169111939
2,2,2-trifluoroethyl 2-[3,4-dihydro-2H-chromen-5-ylmethyl(pyridin-2-ylmethyl)amino]-2-oxoacetate (PubChem CID 169111939) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[3,4-dihydro-2H-chromen-5-ylmethyl(pyridin-2-ylmethyl)amino]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[3,4-dihydro-2H-chromen-5-ylmethyl(pyridin-2-ylmethyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 169111939 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[3,4-dihydro-2H-chromen-5-ylmethyl(pyridin-2-ylmethyl)amino]-2-oxoacetate |
| SMILES | O=C(OCC(F)(F)F)C(=O)N(Cc1ccccn1)Cc1cccc2c1CCCO2 |
| InChI | InChI=1S/C20H19F3N2O4/c21-20(22,23)13-29-19(27)18(26)25(12-15-6-1-2-9-24-15)11-14-5-3-8-17-16(14)7-4-10-28-17/h1-3,5-6,8-9H,4,7,10-13H2 |
| InChIKey | LZRQGHOJHIOPAO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|