C18H19F3N2O — CID 75379624
2-methyl-N-(pyridin-2-ylmethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 75379624) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-methyl-N-(pyridin-2-ylmethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 2-methyl-N-(pyridin-2-ylmethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 75379624 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-methyl-N-(pyridin-2-ylmethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | CC(C)C(=O)N(Cc1cccc(C(F)(F)F)c1)Cc1ccccn1 |
| InChI | InChI=1S/C18H19F3N2O/c1-13(2)17(24)23(12-16-8-3-4-9-22-16)11-14-6-5-7-15(10-14)18(19,20)21/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | FIDXWMYSENYFSC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |