C16H21F3N2O3 — CID 122065197
3-[2-(dimethylamino)ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]-2-methyl-3-oxopropanoic acid (PubChem CID 122065197) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[2-(dimethylamino)ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122065197 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)N(CCN(C)C)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2O3/c1-11(15(23)24)14(22)21(8-7-20(2)3)10-12-5-4-6-13(9-12)16(17,18)19/h4-6,9,11H,7-8,10H2,1-3H3,(H,23,24) |
| InChIKey | GLKYFGNBWQXBJE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|