C16H20F3NO3 — CID 119191026
3-[ethyl-[2-methyl-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]propanoic acid (PubChem CID 119191026) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 3-[ethyl-[2-methyl-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]propanoic acid.
| Compound Name | 3-[ethyl-[2-methyl-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119191026 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3-[ethyl-[2-methyl-3-[3-(trifluoromethyl)phenyl]propanoyl]amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)C(C)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F3NO3/c1-3-20(8-7-14(21)22)15(23)11(2)9-12-5-4-6-13(10-12)16(17,18)19/h4-6,10-11H,3,7-9H2,1-2H3,(H,21,22) |
| InChIKey | IIOVGEUFGOLRRS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |