C17H24FNO3 — CID 119190319
3-[[3-(3-fluorophenyl)-2-methylpropanoyl]-(2-methylpropyl)amino]propanoic acid (PubChem CID 119190319) has the molecular formula C17H24FNO3 and a molecular weight of 309.38 g/mol. Its IUPAC name is 3-[[3-(3-fluorophenyl)-2-methylpropanoyl]-(2-methylpropyl)amino]propanoic acid.
| Compound Name | 3-[[3-(3-fluorophenyl)-2-methylpropanoyl]-(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119190319 |
| Molecular Formula | C17H24FNO3 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 3-[[3-(3-fluorophenyl)-2-methylpropanoyl]-(2-methylpropyl)amino]propanoic acid |
| SMILES | CC(C)CN(CCC(=O)O)C(=O)C(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C17H24FNO3/c1-12(2)11-19(8-7-16(20)21)17(22)13(3)9-14-5-4-6-15(18)10-14/h4-6,10,12-13H,7-9,11H2,1-3H3,(H,20,21) |
| InChIKey | ZVKZGAWERRBTLY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |