C17H24F3N3O3 — CID 122021394
4-[[2-(dimethylamino)ethyl-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl]amino]butanoic acid (PubChem CID 122021394) has the molecular formula C17H24F3N3O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)ethyl-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl]amino]butanoic acid.
| Compound Name | 4-[[2-(dimethylamino)ethyl-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122021394 |
| Molecular Formula | C17H24F3N3O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-[[2-(dimethylamino)ethyl-[[3-(trifluoromethyl)phenyl]methyl]carbamoyl]amino]butanoic acid |
| SMILES | CN(C)CCN(Cc1cccc(C(F)(F)F)c1)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C17H24F3N3O3/c1-22(2)9-10-23(16(26)21-8-4-7-15(24)25)12-13-5-3-6-14(11-13)17(18,19)20/h3,5-6,11H,4,7-10,12H2,1-2H3,(H,21,26)(H,24,25) |
| InChIKey | IVGUGRUHASWOAC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|