C22H19F3N2O3S — CID 20850239
N-[(4-methylsulfonylphenyl)methyl]-N-(pyridin-2-ylmethyl)-4-(trifluoromethyl)benzamide (PubChem CID 20850239) has the molecular formula C22H19F3N2O3S and a molecular weight of 448.47 g/mol. Its IUPAC name is N-[(4-methylsulfonylphenyl)methyl]-N-(pyridin-2-ylmethyl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(4-methylsulfonylphenyl)methyl]-N-(pyridin-2-ylmethyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 20850239 |
| Molecular Formula | C22H19F3N2O3S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[(4-methylsulfonylphenyl)methyl]-N-(pyridin-2-ylmethyl)-4-(trifluoromethyl)benzamide |
| SMILES | CS(=O)(=O)c1ccc(CN(Cc2ccccn2)C(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H19F3N2O3S/c1-31(29,30)20-11-5-16(6-12-20)14-27(15-19-4-2-3-13-26-19)21(28)17-7-9-18(10-8-17)22(23,24)25/h2-13H,14-15H2,1H3 |
| InChIKey | WOGHYCMCXQMABJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |