C17H22N2O2S — CID 50980184
N-methyl-N-[(4-methylsulfonylphenyl)methyl]-1-pyridin-2-ylpropan-2-amine (PubChem CID 50980184) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-methyl-N-[(4-methylsulfonylphenyl)methyl]-1-pyridin-2-ylpropan-2-amine.
| Compound Name | N-methyl-N-[(4-methylsulfonylphenyl)methyl]-1-pyridin-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 50980184 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-methyl-N-[(4-methylsulfonylphenyl)methyl]-1-pyridin-2-ylpropan-2-amine |
| SMILES | CC(Cc1ccccn1)N(C)Cc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H22N2O2S/c1-14(12-16-6-4-5-11-18-16)19(2)13-15-7-9-17(10-8-15)22(3,20)21/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | UVZVFKBASYZUEN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |