C16H24F3NO2Si — CID 132541057
ethyl 2-[[4-(trifluoromethyl)phenyl]methyl-(trimethylsilylmethyl)amino]acetate (PubChem CID 132541057) has the molecular formula C16H24F3NO2Si and a molecular weight of 347.45 g/mol. Its IUPAC name is ethyl 2-[[4-(trifluoromethyl)phenyl]methyl-(trimethylsilylmethyl)amino]acetate.
| Compound Name | ethyl 2-[[4-(trifluoromethyl)phenyl]methyl-(trimethylsilylmethyl)amino]acetate |
|---|---|
| PubChem CID | 132541057 |
| Molecular Formula | C16H24F3NO2Si |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | ethyl 2-[[4-(trifluoromethyl)phenyl]methyl-(trimethylsilylmethyl)amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccc(C(F)(F)F)cc1)C[Si](C)(C)C |
| InChI | InChI=1S/C16H24F3NO2Si/c1-5-22-15(21)11-20(12-23(2,3)4)10-13-6-8-14(9-7-13)16(17,18)19/h6-9H,5,10-12H2,1-4H3 |
| InChIKey | FKBSMJVSXQSMHI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|