C12H9F3N2O2 — CID 164680866
3-(methylamino)-4-[4-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione (PubChem CID 164680866) has the molecular formula C12H9F3N2O2 and a molecular weight of 270.21 g/mol. Its IUPAC name is 3-(methylamino)-4-[4-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(methylamino)-4-[4-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 164680866 |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-(methylamino)-4-[4-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione |
| SMILES | CNc1c(Nc2ccc(C(F)(F)F)cc2)c(=O)c1=O |
| InChI | InChI=1S/C12H9F3N2O2/c1-16-8-9(11(19)10(8)18)17-7-4-2-6(3-5-7)12(13,14)15/h2-5,16-17H,1H3 |
| InChIKey | WLYRTAMTHBGNRV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|