C22H17F3N4O3 — CID 155328307
3-[[3,4-dioxo-2-[4-(trifluoromethyl)anilino]cyclobuten-1-yl]amino]-N,N-dimethyl-1H-indole-5-carboxamide (PubChem CID 155328307) has the molecular formula C22H17F3N4O3 and a molecular weight of 442.40 g/mol. Its IUPAC name is 3-[[3,4-dioxo-2-[4-(trifluoromethyl)anilino]cyclobuten-1-yl]amino]-N,N-dimethyl-1H-indole-5-carboxamide.
| Compound Name | 3-[[3,4-dioxo-2-[4-(trifluoromethyl)anilino]cyclobuten-1-yl]amino]-N,N-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 155328307 |
| Molecular Formula | C22H17F3N4O3 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 3-[[3,4-dioxo-2-[4-(trifluoromethyl)anilino]cyclobuten-1-yl]amino]-N,N-dimethyl-1H-indole-5-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2[nH]cc(Nc3c(Nc4ccc(C(F)(F)F)cc4)c(=O)c3=O)c2c1 |
| InChI | InChI=1S/C22H17F3N4O3/c1-29(2)21(32)11-3-8-15-14(9-11)16(10-26-15)28-18-17(19(30)20(18)31)27-13-6-4-12(5-7-13)22(23,24)25/h3-10,26-28H,1-2H3 |
| InChIKey | WHPBPXAUTIZEBQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|