C22H20F3N4O+ — CID 156720600
1-[5-(1-propan-2-ylazet-1-ium-2-yl)-1H-indol-3-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 156720600) has the molecular formula C22H20F3N4O+ and a molecular weight of 413.42 g/mol. Its IUPAC name is 1-[5-(1-propan-2-ylazet-1-ium-2-yl)-1H-indol-3-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-(1-propan-2-ylazet-1-ium-2-yl)-1H-indol-3-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 156720600 |
| Molecular Formula | C22H20F3N4O+ |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-[5-(1-propan-2-ylazet-1-ium-2-yl)-1H-indol-3-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)[N+]1=C(c2ccc3[nH]cc(NC(=O)Nc4ccc(C(F)(F)F)cc4)c3c2)C=C1 |
| InChI | InChI=1S/C22H19F3N4O/c1-13(2)29-10-9-20(29)14-3-8-18-17(11-14)19(12-26-18)28-21(30)27-16-6-4-15(5-7-16)22(23,24)25/h3-13H,1-2H3,(H2,27,28,30)/p+1 |
| InChIKey | KRLORZZFDPKMBH-UHFFFAOYSA-O |
| XLogP | 5.57 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|