C23H27F3N2O2 — CID 153257049
3-[[(2S)-2-cyclohexylcyclohexyl]amino]-4-[4-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione (PubChem CID 153257049) has the molecular formula C23H27F3N2O2 and a molecular weight of 420.48 g/mol. Its IUPAC name is 3-[[(2S)-2-cyclohexylcyclohexyl]amino]-4-[4-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(2S)-2-cyclohexylcyclohexyl]amino]-4-[4-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 153257049 |
| Molecular Formula | C23H27F3N2O2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-[[(2S)-2-cyclohexylcyclohexyl]amino]-4-[4-(trifluoromethyl)anilino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Nc2ccc(C(F)(F)F)cc2)c(NC2CCCC[C@H]2C2CCCCC2)c1=O |
| InChI | InChI=1S/C23H27F3N2O2/c24-23(25,26)15-10-12-16(13-11-15)27-19-20(22(30)21(19)29)28-18-9-5-4-8-17(18)14-6-2-1-3-7-14/h10-14,17-18,27-28H,1-9H2/t17-,18?/m0/s1 |
| InChIKey | WULYYBSBLDLWGA-ZENAZSQFSA-N |
| XLogP | 5.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|