C33H33F6N3O3Si — CID 57409391
3-[3,5-bis(trifluoromethyl)anilino]-4-[[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 57409391) has the molecular formula C33H33F6N3O3Si and a molecular weight of 661.72 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)anilino]-4-[[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3,5-bis(trifluoromethyl)anilino]-4-[[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 57409391 |
| Molecular Formula | C33H33F6N3O3Si |
| Molecular Weight | 661.72 g/mol |
| Exact Mass | 661.22 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)anilino]-4-[[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H](Nc2c(Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(=O)c2=O)CN1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H33F6N3O3Si/c1-31(2,3)46(25-10-6-4-7-11-25,26-12-8-5-9-13-26)45-19-24-17-23(18-40-24)42-28-27(29(43)30(28)44)41-22-15-20(32(34,35)36)14-21(16-22)33(37,38)39/h4-16,23-24,40-42H,17-19H2,1-3H3/t23-,24+/m1/s1 |
| InChIKey | SCIAWZQBSDTGRC-RPWUZVMVSA-N |
| XLogP | 5.78 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.72 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|